# -*- coding: utf-8 -*-
import copy
import datetime as dt
from collections.abc import Iterable
from types import SimpleNamespace
import numpy as np
import pandas as pd
from numpy.linalg import inv, slogdet
from scipy.stats import norm, gaussian_kde
import statsmodels.base.model as base
import statsmodels.base.wrapper as wrap
from statsmodels.compat.pandas import Appender, Substitution
from statsmodels.iolib.summary import Summary
from statsmodels.regression.linear_model import OLS
from statsmodels.tools.decorators import cache_readonly, cache_writable
from statsmodels.tools.docstring import (Docstring, remove_parameters)
from statsmodels.tools.numdiff import approx_fprime, approx_hess
from statsmodels.tools.validation import array_like, string_like, bool_like, \
int_like
from statsmodels.tsa.arima_process import arma2ma
from statsmodels.tsa.base import tsa_model
from statsmodels.tsa.kalmanf.kalmanfilter import KalmanFilter
from statsmodels.tsa.tsatools import (lagmat, add_trend, _ar_transparams,
_ar_invtransparams, freq_to_period)
from statsmodels.tsa.vector_ar import util
__all__ = ['AR', 'AutoReg']
AR_DEPRECATION_WARN = """
statsmodels.tsa.AR has been deprecated in favor of statsmodels.tsa.AutoReg and
statsmodels.tsa.SARIMAX.
AutoReg adds the ability to specify exogenous variables, include time trends,
and add seasonal dummies. The AutoReg API differs from AR since the model is
treated as immutable, and so the entire specification including the lag
length must be specified when creating the model. This change is too
substantial to incorporate into the existing AR api. The function
ar_select_order performs lag length selection for AutoReg models.
AutoReg only estimates parameters using conditional MLE (OLS). Use SARIMAX to
estimate ARX and related models using full MLE via the Kalman Filter.
To silence this warning and continue using AR until it is removed, use:
import warnings
warnings.filterwarnings('ignore', 'statsmodels.tsa.ar_model.AR', FutureWarning)
"""
REPEATED_FIT_ERROR = """
Model has been fit using maxlag={0}, method={1}, ic={2}, trend={3}. These
cannot be changed in subsequent calls to `fit`. Instead, use a new instance of
AR.
"""
def sumofsq(x, axis=0):
"""Helper function to calculate sum of squares along first axis"""
return np.sum(x ** 2, axis=axis)
def _ar_predict_out_of_sample(y, params, k_ar, k_trend, steps, start=0):
mu = params[:k_trend] if k_trend else 0 # only have to worry constant
arparams = params[k_trend:][::-1] # reverse for dot
# dynamic endogenous variable
endog = np.zeros(k_ar + steps) # this is one too big but does not matter
if start:
endog[:k_ar] = y[start - k_ar:start]
else:
endog[:k_ar] = y[-k_ar:]
forecast = np.zeros(steps)
for i in range(steps):
fcast = mu + np.dot(arparams, endog[i:i + k_ar])
forecast[i] = fcast
endog[i + k_ar] = fcast
return forecast
[docs]class AutoReg(tsa_model.TimeSeriesModel):
"""
Autoregressive AR-X(p) model.
Estimate an AR-X model using Conditional Maximum Likelihood (OLS).
Parameters
----------
endog : array_like
A 1-d endogenous response variable. The independent variable.
lags : {int, list[int]}
The number of lags to include in the model if an integer or the
list of lag indices to include. For example, [1, 4] will only
include lags 1 and 4 while lags=4 will include lags 1, 2, 3, and 4.
trend : {'n', 'c', 't', 'ct'}
The trend to include in the model:
* 'n' - No trend.
* 'c' - Constant only.
* 't' - Time trend only.
* 'ct' - Constant and time trend.
seasonal : bool
Flag indicating whether to include seasonal dummies in the model. If
seasonal is True and trend includes 'c', then the first period
is excluded from the seasonal terms.
exog : array_like, optional
Exogenous variables to include in the model. Must have the same number
of observations as endog and should be aligned so that endog[i] is
regressed on exog[i].
hold_back : {None, int}
Initial observations to exclude from the estimation sample. If None,
then hold_back is equal to the maximum lag in the model. Set to a
non-zero value to produce comparable models with different lag
length. For example, to compare the fit of a model with lags=3 and
lags=1, set hold_back=3 which ensures that both models are estimated
using observations 3,...,nobs. hold_back must be >= the maximum lag in
the model.
period : {None, int}
The period of the data. Only used if seasonal is True. This parameter
can be omitted if using a pandas object for endog that contains a
recognized frequency.
missing : str
Available options are 'none', 'drop', and 'raise'. If 'none', no nan
checking is done. If 'drop', any observations with nans are dropped.
If 'raise', an error is raised. Default is 'none'.
See Also
--------
statsmodels.tsa.statespace.sarimax.SARIMAX
Estimation of SARIMAX models using exact likelihood and the
Kalman Filter.
Examples
--------
>>> import statsmodels.api as sm
>>> from statsmodels.tsa.ar_model import AutoReg
>>> data = sm.datasets.sunspots.load_pandas().data['SUNACTIVITY']
>>> out = 'AIC: {0:0.3f}, HQIC: {1:0.3f}, BIC: {2:0.3f}'
Start by fitting an unrestricted Seasonal AR model
>>> res = AutoReg(data, lags = [1, 11, 12]).fit()
>>> print(out.format(res.aic, res.hqic, res.bic))
AIC: 5.945, HQIC: 5.970, BIC: 6.007
An alternative used seasonal dummies
>>> res = AutoReg(data, lags=1, seasonal=True, period=11).fit()
>>> print(out.format(res.aic, res.hqic, res.bic))
AIC: 6.017, HQIC: 6.080, BIC: 6.175
Finally, both the seasonal AR structure and dummies can be included
>>> res = AutoReg(data, lags=[1, 11, 12], seasonal=True, period=11).fit()
>>> print(out.format(res.aic, res.hqic, res.bic))
AIC: 5.884, HQIC: 5.959, BIC: 6.071
"""
def __init__(self, endog, lags, trend='c', seasonal=False, exog=None,
hold_back=None, period=None, missing='none'):
super(AutoReg, self).__init__(endog, exog, None, None,
missing=missing)
self._trend = string_like(trend, 'trend',
options=('n', 'c', 't', 'ct'))
self._seasonal = bool_like(seasonal, 'seasonal')
self._period = int_like(period, 'period', optional=True)
if self._period is None and self._seasonal:
if self.data.freq:
self._period = freq_to_period(self._index_freq)
else:
err = 'freq cannot be inferred from endog and model includes' \
' seasonal terms. The number of periods must be ' \
'explicitly set when the endog\'s index does not ' \
'contain a frequency.'
raise ValueError(err)
self._lags = lags
self._exog_names = []
self._k_ar = 0
self._hold_back = int_like(hold_back, 'hold_back', optional=True)
self._check_lags()
self._setup_regressors()
self.nobs = self._y.shape[0]
self.data.xnames = self.exog_names
@property
def ar_lags(self):
"""The autoregressive lags included in the model"""
return self._lags
@property
def hold_back(self):
"""The number of initial obs. excluded from the estimation sample."""
return self._hold_back
@property
def seasonal(self):
"""Flag indicating that the model contains a seasonal component."""
return self._seasonal
@property
def df_model(self):
"""The model degrees of freedom."""
return self._x.shape[1]
@property
def exog_names(self):
"""Names of exogenous variables included in model"""
return self._exog_names
[docs] def initialize(self):
"""Initialize the model (no-op)."""
pass
def _check_lags(self):
lags = self._lags
if isinstance(lags, Iterable):
lags = np.array(sorted([int_like(lag, 'lags') for lag in lags]))
self._lags = lags
if np.any(lags < 1) or np.unique(lags).shape[0] != lags.shape[0]:
raise ValueError('All values in lags must be positive and '
'distinct.')
self._maxlag = np.max(lags)
else:
self._maxlag = int_like(lags, 'lags')
if self._maxlag < 0:
raise ValueError('lags must be a positive scalar.')
self._lags = np.arange(1, self._maxlag + 1)
if self._hold_back is None:
self._hold_back = self._maxlag
if self._hold_back < self._maxlag:
raise ValueError('hold_back must be >= lags if lags is an int or'
'max(lags) if lags is array_like.')
def _setup_regressors(self):
maxlag = self._maxlag
hold_back = self._hold_back
exog_names = []
endog_names = self.endog_names
x, y = lagmat(self.endog, maxlag, original='sep')
exog_names.extend([endog_names + '.L{0}'.format(lag)
for lag in self._lags])
if len(self._lags) < maxlag:
x = x[:, self._lags - 1]
self._k_ar = x.shape[1]
if self._seasonal:
nobs, period = self.endog.shape[0], self._period
season_names = ['seasonal.{0}'.format(i) for i in range(period)]
dummies = np.zeros((nobs, period))
for i in range(period):
dummies[i::period, i] = 1
if 'c' in self._trend:
dummies = dummies[:, 1:]
season_names = season_names[1:]
x = np.c_[dummies, x]
exog_names = season_names + exog_names
x = add_trend(x, trend=self._trend, prepend=True)
if 't' in self._trend:
exog_names.insert(0, 'trend')
if 'c' in self._trend:
exog_names.insert(0, 'intercept')
if self.exog is not None:
x = np.c_[x, self.exog]
exog_names.extend(self.data.param_names)
y = y[hold_back:]
x = x[hold_back:]
if y.shape[0] < x.shape[1]:
reg = x.shape[1]
trend = 0 if self._trend == 'n' else len(self._trend)
seas = 0 if not self._seasonal else period - ('c' in self._trend)
lags = self._lags.shape[0]
nobs = y.shape[0]
raise ValueError('The model specification cannot be estimated. '
'The model contains {0} regressors ({1} trend, '
'{2} seasonal, {3} lags) but after adjustment '
'for hold_back and creation of the lags, there '
'are only {4} data points available to estimate '
'parameters.'.format(reg, trend, seas, lags,
nobs))
self._y, self._x = y, x
self._exog_names = exog_names
[docs] def fit(self, cov_type='nonrobust', cov_kwds=None, use_t=False):
"""
Estimate the model parameters.
Parameters
----------
cov_type : str
The covariance estimator to use. The most common choices are listed
below. Supports all covariance estimators that are available
in ``OLS.fit``.
* 'nonrobust' - The class OLS covariance estimator that assumes
homoskedasticity.
* 'HC0', 'HC1', 'HC2', 'HC3' - Variants of White's
(or Eiker-Huber-White) covariance estimator. `HC0` is the
standard implementation. The other make corrections to improve
the finite sample performance of the heteroskedasticity robust
covariance estimator.
* 'HAC' - Heteroskedasticity-autocorrelation robust covariance
estimation. Supports cov_kwds.
- `maxlag` integer (required) : number of lags to use.
- `kernel` callable or str (optional) : kernel
currently available kernels are ['bartlett', 'uniform'],
default is Bartlett.
- `use_correction` bool (optional) : If true, use small sample
correction.
cov_kwds : dict, optional
A dictionary of keyword arguments to pass to the covariance
estimator. `nonrobust` and `HC#` do not support cov_kwds.
use_t : bool, optional
A flag indicating that inference should use the Student's t
distribution that accounts for model degree of freedom. If False,
uses the normal distribution. If None, defers the choice to
the cov_type. It also removes degree of freedom corrections from
the covariance estimator when cov_type is 'nonrobust'.
Returns
-------
AutoRegResults
Estimation results.
See Also
--------
statsmodels.regression.linear_model.OLS
Ordinary Least Squares estimation.
statsmodels.regression.linear_model.RegressionResults
See ``get_robustcov_results`` for a detailed list of available
covariance estimators and options.
Notes
-----
Use ``OLS`` to estimate model parameters and to estimate parameter
covariance.
"""
# TODO: Determine correction for degree-of-freedom
# Special case parameterless model
if self._x.shape[1] == 0:
return AutoRegResultsWrapper(AutoRegResults(self,
np.empty(0),
np.empty((0, 0))))
ols_mod = OLS(self._y, self._x)
ols_res = ols_mod.fit(cov_type=cov_type, cov_kwds=cov_kwds,
use_t=use_t)
cov_params = ols_res.cov_params()
use_t = ols_res.use_t
if cov_type == "nonrobust" and not use_t:
nobs = self._y.shape[0]
k = self._x.shape[1]
scale = nobs / (nobs - k)
cov_params /= scale
res = AutoRegResults(self, ols_res.params, cov_params,
ols_res.normalized_cov_params)
return AutoRegResultsWrapper(res)
def _resid(self, params):
params = array_like(params, 'params', ndim=2)
resid = self._y - self._x @ params
return resid.squeeze()
[docs] def loglike(self, params):
"""
Log-likelihood of model.
Parameters
----------
params : ndarray
The model parameters used to compute the log-likelihood.
Returns
-------
float
The log-likelihood value.
"""
nobs = self.nobs
resid = self._resid(params)
ssr = resid @ resid
llf = -(nobs / 2) * (np.log(2 * np.pi) + np.log(ssr / nobs) + 1)
return llf
[docs] def score(self, params):
"""
Score vector of model.
The gradient of logL with respect to each parameter.
Parameters
----------
params : ndarray
The parameters to use when evaluating the Hessian.
Returns
-------
ndarray
The score vector evaluated at the parameters.
"""
resid = self._resid(params)
return self._x.T @ resid
[docs] def hessian(self, params):
"""
The Hessian matrix of the model.
Parameters
----------
params : ndarray
The parameters to use when evaluating the Hessian.
Returns
-------
ndarray
The hessian evaluated at the parameters.
"""
return -self.information(params)
def _setup_oos_forecast(self, add_forecasts, exog_oos):
full_nobs = self.data.endog.shape[0]
x = np.zeros((add_forecasts, self._x.shape[1]))
loc = 0
if 'c' in self._trend:
x[:, 0] = 1
loc += 1
if 't' in self._trend:
x[:, loc] = np.arange(full_nobs + 1, full_nobs + add_forecasts + 1)
loc += 1
if self.seasonal:
seasonal = np.zeros((add_forecasts, self._period))
period = self._period
col = full_nobs % period
for i in range(period):
seasonal[i::period, (col + i) % period] = 1
if 'c' in self._trend:
x[:, loc:loc + period - 1] = seasonal[:, 1:]
loc += seasonal.shape[1] - 1
else:
x[:, loc:loc + period] = seasonal
loc += seasonal.shape[1]
# skip the AR columns
loc += len(self._lags)
if self.exog is not None:
x[:, loc:] = exog_oos[:add_forecasts]
return x
def _wrap_prediction(self, prediction, start, end):
if not isinstance(self.data.orig_endog, (pd.Series, pd.DataFrame)):
return prediction
index = self.data.orig_endog.index
if end > self.endog.shape[0]:
freq = getattr(index, 'freq', None)
if freq:
index = pd.date_range(index[0], freq=freq, periods=end)
else:
index = pd.RangeIndex(end)
index = index[start:end]
return pd.Series(prediction, index=index)
def _dynamic_predict(self, params, start, end, dynamic, num_oos, exog,
exog_oos):
"""
:param params:
:param start:
:param end:
:param dynamic:
:param num_oos:
:param exog:
:param exog_oos:
:return:
"""
reg = []
hold_back = self._hold_back
if (start - hold_back) <= self.nobs:
is_loc = slice(start - hold_back, end + 1 - hold_back)
x = self._x[is_loc]
if exog is not None:
x = x.copy()
# Replace final columns
x[:, -exog.shape[1]:] = exog[start:end + 1]
reg.append(x)
if num_oos > 0:
reg.append(self._setup_oos_forecast(num_oos, exog_oos))
reg = np.vstack(reg)
det_col_idx = self._x.shape[1] - len(self._lags)
det_col_idx -= 0 if self.exog is None else self.exog.shape[1]
# + 1 is due t0 inclusiveness of predict functions
adj_dynamic = dynamic - start + 1
forecasts = np.empty(reg.shape[0])
forecasts[:adj_dynamic] = reg[:adj_dynamic] @ params
for h in range(adj_dynamic, reg.shape[0]):
# Fill in regressor matrix
for j, lag in enumerate(self._lags):
fcast_loc = h - lag
if fcast_loc >= 0:
val = forecasts[fcast_loc]
else:
# If before the start of the forecasts, use actual values
val = self.endog[start + fcast_loc]
reg[h, det_col_idx + j] = val
forecasts[h] = reg[h:h + 1] @ params
return self._wrap_prediction(forecasts, start, end + 1 + num_oos)
def _static_oos_predict(self, params, num_oos, exog_oos):
new_x = self._setup_oos_forecast(num_oos, exog_oos)
if self._maxlag == 0:
return new_x @ params
forecasts = np.empty(num_oos)
nexog = 0 if self.exog is None else self.exog.shape[1]
ar_offset = self._x.shape[1] - nexog - self._lags.shape[0]
for i in range(num_oos):
for j, lag in enumerate(self._lags):
loc = i - lag
val = self._y[loc] if loc < 0 else forecasts[loc]
new_x[i, ar_offset + j] = val
forecasts[i] = new_x[i:i + 1] @ params
return forecasts
def _static_predict(self, params, start, end, num_oos, exog, exog_oos):
"""
Path for static predictions
Parameters
----------
start : int
Index of first observation
end : int
Index of last in-sample observation. Inclusive, so start:end+1
in slice notation.
num_oos : int
Number of out-of-sample observations, so that the returned size is
num_oos + (end - start + 1).
exog : ndarray
Array containing replacement exog values
exog_oos : ndarray
Containing forecast exog values
"""
hold_back = self._hold_back
nobs = self.endog.shape[0]
x = np.empty((0, self._x.shape[1]))
if start <= nobs:
is_loc = slice(start - hold_back, end + 1 - hold_back)
x = self._x[is_loc]
if exog is not None:
x = x.copy()
# Replace final columns
x[:, -exog.shape[1]:] = exog[start:end + 1]
in_sample = x @ params
if num_oos == 0: # No out of sample
return self._wrap_prediction(in_sample, start, end + 1)
out_of_sample = self._static_oos_predict(params, num_oos, exog_oos)
prediction = np.hstack((in_sample, out_of_sample))
return self._wrap_prediction(prediction, start, end + 1 + num_oos)
[docs] def predict(self, params, start=None, end=None, dynamic=False, exog=None,
exog_oos=None):
"""
In-sample prediction and out-of-sample forecasting.
Parameters
----------
params : array_like
The fitted model parameters.
start : int, str, or datetime, optional
Zero-indexed observation number at which to start forecasting,
i.e., the first forecast is start. Can also be a date string to
parse or a datetime type. Default is the the zeroth observation.
end : int, str, or datetime, optional
Zero-indexed observation number at which to end forecasting, i.e.,
the last forecast is end. Can also be a date string to
parse or a datetime type. However, if the dates index does not
have a fixed frequency, end must be an integer index if you
want out-of-sample prediction. Default is the last observation in
the sample. Unlike standard python slices, end is inclusive so
that all the predictions [start, start+1, ..., end-1, end] are
returned.
dynamic : {bool, int, str, datetime, Timestamp}, optional
Integer offset relative to `start` at which to begin dynamic
prediction. Prior to this observation, true endogenous values
will be used for prediction; starting with this observation and
continuing through the end of prediction, forecasted endogenous
values will be used instead. Datetime-like objects are not
interpreted as offsets. They are instead used to find the index
location of `dynamic` which is then used to to compute the offset.
exog : array_like
A replacement exogenous array. Must have the same shape as the
exogenous data array used when the model was created.
exog_oos : array_like
An array containing out-of-sample values of the exogenous variable.
Must has the same number of columns as the exog used when the
model was created, and at least as many rows as the number of
out-of-sample forecasts.
Returns
-------
array_like
Array of out of in-sample predictions and / or out-of-sample
forecasts. An (npredict x k_endog) array.
"""
params = array_like(params, 'params')
exog = array_like(exog, 'exog', ndim=2, optional=True)
exog_oos = array_like(exog_oos, 'exog_oos', ndim=2, optional=True)
start = 0 if start is None else start
end = self._index[-1] if end is None else end
start, end, num_oos, _ = self._get_prediction_index(start, end)
start = max(start, self._hold_back)
if self.exog is None and (exog is not None or exog_oos is not None):
raise ValueError('exog and exog_oos cannot be used when the model '
'does not contains exogenous regressors.')
elif self.exog is not None:
if exog is not None and exog.shape != self.exog.shape:
msg = ('The shape of exog {0} must match the shape of the '
'exog variable used to create the model {1}.')
raise ValueError(msg.format(exog.shape, self.exog.shape))
if exog_oos is not None and \
exog_oos.shape[1] != self.exog.shape[1]:
msg = ('The number of columns in exog_oos ({0}) must match '
'the number of columns in the exog variable used to '
'create the model ({1}).')
raise ValueError(msg.format(exog_oos.shape[1],
self.exog.shape[1]))
if num_oos > 0 and exog_oos is None:
raise ValueError('exog_oos must be provided when producing '
'out-of-sample forecasts.')
elif exog_oos is not None and num_oos > exog_oos.shape[0]:
msg = ('start and end indicate that {0} out-of-sample '
'predictions must be computed. exog_oos has {1} rows '
'but must have at least {0}.')
raise ValueError(msg.format(num_oos, exog_oos.shape[0]))
if (isinstance(dynamic, bool) and not dynamic) or self._maxlag == 0:
# If model has no lags, static and dynamic are identical
return self._static_predict(params, start, end, num_oos,
exog, exog_oos)
if isinstance(dynamic, (str, bytes, pd.Timestamp, dt.datetime)):
dynamic, _, _ = self._get_index_loc(dynamic)
offset = dynamic - start
elif dynamic is True:
# if True, all forecasts are dynamic, except start
offset = 0
else:
offset = int(dynamic)
dynamic = start + offset
if dynamic < 0:
raise ValueError('Dynamic prediction cannot begin prior to the'
' first observation in the sample.')
return self._dynamic_predict(params, start, end, dynamic, num_oos,
exog, exog_oos)
[docs]class AR(tsa_model.TimeSeriesModel):
__doc__ = tsa_model._tsa_doc % {"model": "Autoregressive AR(p) model.\n\n"
" .. deprecated:: 0.11",
"params": """endog : array_like
A 1-d endogenous response variable. The independent variable.""",
"extra_params": base._missing_param_doc,
"extra_sections": ""}
def __init__(self, endog, dates=None, freq=None, missing='none'):
import warnings
warnings.warn(AR_DEPRECATION_WARN, FutureWarning)
super(AR, self).__init__(endog, None, dates, freq, missing=missing)
endog = self.endog # original might not have been an ndarray
if endog.ndim == 1:
endog = endog[:, None]
self.endog = endog # to get shapes right
elif endog.ndim > 1 and endog.shape[1] != 1:
raise ValueError("Only the univariate case is implemented")
self._fit_params = None
[docs] def initialize(self):
"""Initialization of the model (no-op)."""
pass
def _transparams(self, params):
"""
Transforms params to induce stationarity/invertability.
Reference
---------
Jones(1980)
"""
p = self.k_ar
k = self.k_trend
newparams = params.copy()
newparams[k:k + p] = _ar_transparams(params[k:k + p].copy())
return newparams
def _invtransparams(self, start_params):
"""
Inverse of the Jones reparameterization
"""
p = self.k_ar
k = self.k_trend
newparams = start_params.copy()
newparams[k:k + p] = _ar_invtransparams(start_params[k:k + p].copy())
return newparams
def _presample_fit(self, params, start, p, end, y, predictedvalues):
"""
Return the pre-sample predicted values using the Kalman Filter
Notes
-----
See predict method for how to use start and p.
"""
k = self.k_trend
# build system matrices
T_mat = KalmanFilter.T(params, p, k, p)
R_mat = KalmanFilter.R(params, p, k, 0, p)
# Initial State mean and variance
alpha = np.zeros((p, 1))
Q_0 = np.dot(inv(np.identity(p ** 2) - np.kron(T_mat, T_mat)),
np.dot(R_mat, R_mat.T).ravel('F'))
Q_0 = Q_0.reshape(p, p, order='F') # TODO: order might need to be p+k
P = Q_0
Z_mat = KalmanFilter.Z(p)
for i in range(end): # iterate p-1 times to fit presample
v_mat = y[i] - np.dot(Z_mat, alpha)
F_mat = np.dot(np.dot(Z_mat, P), Z_mat.T)
Finv = 1. / F_mat # inv. always scalar
K = np.dot(np.dot(np.dot(T_mat, P), Z_mat.T), Finv)
# update state
alpha = np.dot(T_mat, alpha) + np.dot(K, v_mat)
L = T_mat - np.dot(K, Z_mat)
P = np.dot(np.dot(T_mat, P), L.T) + np.dot(R_mat, R_mat.T)
if i >= start - 1: # only record if we ask for it
predictedvalues[i + 1 - start] = np.dot(Z_mat, alpha)
def _get_prediction_index(self, start, end, dynamic, index=None):
method = getattr(self, 'method', 'mle')
k_ar = getattr(self, 'k_ar', 0)
if start is None:
if method == 'mle' and not dynamic:
start = 0
else: # cannot do presample fit for cmle or dynamic
start = k_ar
start = self._index[start]
if end is None:
end = self._index[-1]
start, end, out_of_sample, prediction_index = (
super(AR, self)._get_prediction_index(start, end, index))
# Other validation
if (method == 'cmle' or dynamic) and start < k_ar:
raise ValueError("Start must be >= k_ar for conditional MLE "
"or dynamic forecast. Got %d" % start)
return start, end, out_of_sample, prediction_index
[docs] def predict(self, params, start=None, end=None, dynamic=False):
"""
Construct in-sample and out-of-sample prediction.
Parameters
----------
params : ndarray
The fitted model parameters.
start : int, str, or datetime
Zero-indexed observation number at which to start forecasting, ie.,
the first forecast is start. Can also be a date string to
parse or a datetime type.
end : int, str, or datetime
Zero-indexed observation number at which to end forecasting, ie.,
the first forecast is start. Can also be a date string to
parse or a datetime type.
dynamic : bool
The `dynamic` keyword affects in-sample prediction. If dynamic
is False, then the in-sample lagged values are used for
prediction. If `dynamic` is True, then in-sample forecasts are
used in place of lagged dependent variables. The first forecasted
value is `start`.
Returns
-------
array_like
An array containing the predicted values.
Notes
-----
The linear Gaussian Kalman filter is used to return pre-sample fitted
values. The exact initial Kalman Filter is used. See Durbin and Koopman
in the references for more information.
"""
if not (hasattr(self, 'k_ar') and hasattr(self, 'k_trend')):
raise RuntimeError('Model must be fit before calling predict')
# will return an index of a date
start, end, out_of_sample, _ = (
self._get_prediction_index(start, end, dynamic))
k_ar = self.k_ar
k_trend = self.k_trend
method = self.method
endog = self.endog.squeeze()
if dynamic:
out_of_sample += end - start + 1
return _ar_predict_out_of_sample(endog, params, k_ar,
k_trend, out_of_sample, start)
predictedvalues = np.zeros(end + 1 - start)
# fit pre-sample
if method == 'mle': # use Kalman Filter to get initial values
if k_trend:
mu = params[0] / (1 - np.sum(params[k_trend:]))
else:
mu = 0
# modifies predictedvalues in place
if start < k_ar:
self._presample_fit(params, start, k_ar, min(k_ar - 1, end),
endog[:k_ar] - mu, predictedvalues)
predictedvalues[:k_ar - start] += mu
if end < k_ar:
return predictedvalues
# just do the whole thing and truncate
fittedvalues = np.dot(self.X, params)
pv_start = max(k_ar - start, 0)
fv_start = max(start - k_ar, 0)
fv_end = min(len(fittedvalues), end - k_ar + 1)
predictedvalues[pv_start:] = fittedvalues[fv_start:fv_end]
if out_of_sample:
forecastvalues = _ar_predict_out_of_sample(endog, params,
k_ar, k_trend,
out_of_sample)
predictedvalues = np.r_[predictedvalues, forecastvalues]
return predictedvalues
def _presample_varcov(self, params):
"""
Returns the inverse of the presample variance-covariance.
Notes
-----
See Hamilton p. 125
"""
k = self.k_trend
p = self.k_ar
# get inv(Vp) Hamilton 5.3.7
params0 = np.r_[-1, params[k:]]
Vpinv = np.zeros((p, p), dtype=params.dtype)
for i in range(1, p + 1):
Vpinv[i - 1, i - 1:] = np.correlate(params0, params0[:i])[:-1]
Vpinv[i - 1, i - 1:] -= np.correlate(params0[-i:], params0)[:-1]
Vpinv = Vpinv + Vpinv.T - np.diag(Vpinv.diagonal())
return Vpinv
def _loglike_css(self, params):
"""
Loglikelihood of AR(p) process using conditional sum of squares
"""
nobs = self.nobs
Y = self.Y
X = self.X
ssr = sumofsq(Y.squeeze() - np.dot(X, params))
sigma2 = ssr / nobs
return -nobs / 2 * (np.log(2 * np.pi) + np.log(sigma2) + 1)
def _loglike_mle(self, params):
"""
Loglikelihood of AR(p) process using exact maximum likelihood
"""
nobs = self.nobs
X = self.X
endog = self.endog
k_ar = self.k_ar
k_trend = self.k_trend
# reparameterize according to Jones (1980) like in ARMA/Kalman Filter
if self.transparams:
params = self._transparams(params)
# get mean and variance for pre-sample lags
yp = endog[:k_ar].copy()
if k_trend:
c = [params[0]] * k_ar
else:
c = [0]
mup = np.asarray(c / (1 - np.sum(params[k_trend:])))
diffp = yp - mup[:, None]
# get inv(Vp) Hamilton 5.3.7
Vpinv = self._presample_varcov(params)
diffpVpinv = np.dot(np.dot(diffp.T, Vpinv), diffp).item()
ssr = sumofsq(endog[k_ar:].squeeze() - np.dot(X, params))
# concentrating the likelihood means that sigma2 is given by
sigma2 = 1. / nobs * (diffpVpinv + ssr)
self.sigma2 = sigma2
logdet = slogdet(Vpinv)[1] # TODO: add check for singularity
loglike = -1 / 2. * (nobs * (np.log(2 * np.pi) + np.log(sigma2))
- logdet + diffpVpinv / sigma2 + ssr / sigma2)
return loglike
[docs] def loglike(self, params):
r"""
The loglikelihood of an AR(p) process.
Parameters
----------
params : ndarray
The fitted parameters of the AR model.
Returns
-------
float
The loglikelihood evaluated at `params`.
Notes
-----
Contains constant term. If the model is fit by OLS then this returns
the conditional maximum likelihood.
.. math::
\frac{\left(n-p\right)}{2}\left(\log\left(2\pi\right)
+\log\left(\sigma^{2}\right)\right)
-\frac{1}{\sigma^{2}}\sum_{i}\epsilon_{i}^{2}
If it is fit by MLE then the (exact) unconditional maximum likelihood
is returned.
.. math::
-\frac{n}{2}log\left(2\pi\right)
-\frac{n}{2}\log\left(\sigma^{2}\right)
+\frac{1}{2}\left|V_{p}^{-1}\right|
-\frac{1}{2\sigma^{2}}\left(y_{p}
-\mu_{p}\right)^{\prime}V_{p}^{-1}\left(y_{p}-\mu_{p}\right)
-\frac{1}{2\sigma^{2}}\sum_{t=p+1}^{n}\epsilon_{i}^{2}
where
:math:`\mu_{p}` is a (`p` x 1) vector with each element equal to the
mean of the AR process and :math:`\sigma^{2}V_{p}` is the (`p` x `p`)
variance-covariance matrix of the first `p` observations.
"""
# Math is on Hamilton ~pp 124-5
if self.method == "cmle":
return self._loglike_css(params)
else:
return self._loglike_mle(params)
[docs] def score(self, params):
"""
Compute the gradient of the log-likelihood at params.
Parameters
----------
params : array_like
The parameter values at which to evaluate the score function.
Returns
-------
ndarray
The gradient computed using numerical methods.
"""
loglike = self.loglike
return approx_fprime(params, loglike, epsilon=1e-8)
[docs] def hessian(self, params):
"""
Compute the hessian using a numerical approximation.
Parameters
----------
params : ndarray
The model parameters.
Returns
-------
ndarray
The hessian evaluated at params.
"""
loglike = self.loglike
return approx_hess(params, loglike)
def _stackX(self, k_ar, trend):
"""
Private method to build the RHS matrix for estimation.
Columns are trend terms then lags.
"""
endog = self.endog
X = lagmat(endog, maxlag=k_ar, trim='both')
k_trend = util.get_trendorder(trend)
if k_trend:
X = add_trend(X, prepend=True, trend=trend, has_constant="raise")
self.k_trend = k_trend
return X
[docs] def select_order(self, maxlag, ic, trend='c', method='mle'):
"""
Select the lag order according to the information criterion.
Parameters
----------
maxlag : int
The highest lag length tried. See `AR.fit`.
ic : {'aic','bic','hqic','t-stat'}
Criterion used for selecting the optimal lag length.
See `AR.fit`.
trend : {'c','nc'}
Whether to include a constant or not. 'c' - include constant.
'nc' - no constant.
method : {'cmle', 'mle'}, optional
The method to use in estimation.
* 'cmle' - Conditional maximum likelihood using OLS
* 'mle' - Unconditional (exact) maximum likelihood. See `solver`
and the Notes.
Returns
-------
int
Best lag according to the information criteria.
"""
endog = self.endog
# make Y and X with same nobs to compare ICs
Y = endog[maxlag:]
self.Y = Y # attach to get correct fit stats
X = self._stackX(maxlag, trend) # sets k_trend
self.X = X
k = self.k_trend # k_trend set in _stackX
k = max(1, k) # handle if startlag is 0
results = {}
if ic != 't-stat':
for lag in range(k, maxlag + 1):
# have to reinstantiate the model to keep comparable models
endog_tmp = endog[maxlag - lag:]
fit = AR(endog_tmp).fit(maxlag=lag, method=method,
full_output=0, trend=trend,
maxiter=100, disp=0)
results[lag] = getattr(fit, ic)
bestic, bestlag = min((res, k) for k, res in results.items())
else: # choose by last t-stat.
stop = 1.6448536269514722 # for t-stat, norm.ppf(.95)
for lag in range(maxlag, k - 1, -1):
# have to reinstantiate the model to keep comparable models
endog_tmp = endog[maxlag - lag:]
fit = AR(endog_tmp).fit(maxlag=lag, method=method,
full_output=0, trend=trend,
maxiter=35, disp=-1)
bestlag = 0
if np.abs(fit.tvalues[-1]) >= stop:
bestlag = lag
break
return bestlag
[docs] def fit(self, maxlag=None, method='cmle', ic=None, trend='c',
transparams=True, start_params=None, solver='lbfgs', maxiter=35,
full_output=1, disp=1, callback=None, **kwargs):
"""
Fit the unconditional maximum likelihood of an AR(p) process.
Parameters
----------
maxlag : int
If `ic` is None, then maxlag is the lag length used in fit. If
`ic` is specified then maxlag is the highest lag order used to
select the correct lag order. If maxlag is None, the default is
round(12*(nobs/100.)**(1/4.)).
method : {'cmle', 'mle'}, optional
The method to use in estimation.
* 'cmle' - Conditional maximum likelihood using OLS
* 'mle' - Unconditional (exact) maximum likelihood. See `solver`
and the Notes.
ic : {'aic','bic','hic','t-stat'}
Criterion used for selecting the optimal lag length.
* 'aic' - Akaike Information Criterion
* 'bic' - Bayes Information Criterion
* 't-stat' - Based on last lag
* 'hqic' - Hannan-Quinn Information Criterion
If any of the information criteria are selected, the lag length
which results in the lowest value is selected. If t-stat, the
model starts with maxlag and drops a lag until the highest lag
has a t-stat that is significant at the 95 % level.
trend : {'c','nc'}
Whether to include a constant or not.
* 'c' - include constant.
* 'nc' - no constant.
transparams : bool, optional
Whether or not to transform the parameters to ensure stationarity.
Uses the transformation suggested in Jones (1980).
start_params : array_like, optional
A first guess on the parameters. Default is cmle estimates.
solver : str or None, optional
Solver to be used if method is 'mle'. The default is 'lbfgs'
(limited memory Broyden-Fletcher-Goldfarb-Shanno). Other choices
are 'bfgs', 'newton' (Newton-Raphson), 'nm' (Nelder-Mead),
'cg' - (conjugate gradient), 'ncg' (non-conjugate gradient),
and 'powell'.
maxiter : int, optional
The maximum number of function evaluations. Default is 35.
full_output : bool, optional
If True, all output from solver will be available in
the Results object's mle_retvals attribute. Output is dependent
on the solver. See Notes for more information.
disp : bool, optional
If True, convergence information is output.
callback : function, optional
Called after each iteration as callback(xk) where xk is the current
parameter vector.
**kwargs
See LikelihoodModel.fit for keyword arguments that can be passed
to fit.
Returns
-------
ARResults
Results instance.
See Also
--------
statsmodels.base.model.LikelihoodModel.fit
Base fit class with further details about options.
Notes
-----
The parameters after `trend` are only used when method is 'mle'.
References
----------
.. [*] Jones, R.H. 1980 "Maximum likelihood fitting of ARMA models to
time series with missing observations." `Technometrics`. 22.3.
389-95.
"""
start_params = array_like(start_params, 'start_params', ndim=1,
optional=True)
method = method.lower()
if method not in ['cmle', 'mle']:
raise ValueError("Method %s not recognized" % method)
self.method = method
self.trend = trend
self.transparams = transparams
nobs = len(self.endog) # overwritten if method is 'cmle'
endog = self.endog
# The parameters are no longer allowed to change in an instance
fit_params = (maxlag, method, ic, trend)
if self._fit_params is not None and self._fit_params != fit_params:
raise RuntimeError(REPEATED_FIT_ERROR.format(*self._fit_params))
if maxlag is None:
maxlag = int(round(12 * (nobs / 100.) ** (1 / 4.)))
k_ar = maxlag # stays this if ic is None
# select lag length
if ic is not None:
ic = ic.lower()
if ic not in ['aic', 'bic', 'hqic', 't-stat']:
raise ValueError("ic option %s not understood" % ic)
k_ar = self.select_order(k_ar, ic, trend, method)
self.k_ar = k_ar # change to what was chosen by ic
# redo estimation for best lag
# make LHS
Y = endog[k_ar:, :]
# make lagged RHS
X = self._stackX(k_ar, trend) # sets self.k_trend
k_trend = self.k_trend
self.exog_names = util.make_lag_names(self.endog_names, k_ar, k_trend)
self.Y = Y
self.X = X
if method == "cmle": # do OLS
arfit = OLS(Y, X).fit()
params = arfit.params
self.nobs = nobs - k_ar
self.sigma2 = arfit.ssr / arfit.nobs # needed for predict fcasterr
else: # method == "mle"
solver = solver.lower()
self.nobs = nobs
if start_params is None:
start_params = OLS(Y, X).fit().params
else:
if len(start_params) != k_trend + k_ar:
raise ValueError("Length of start params is %d. There"
" are %d parameters." %
(len(start_params), k_trend + k_ar))
start_params = self._invtransparams(start_params)
if solver == 'lbfgs':
kwargs.setdefault('pgtol', 1e-8)
kwargs.setdefault('factr', 1e2)
kwargs.setdefault('m', 12)
kwargs.setdefault('approx_grad', True)
mlefit = super(AR, self).fit(start_params=start_params,
method=solver, maxiter=maxiter,
full_output=full_output, disp=disp,
callback=callback, **kwargs)
params = mlefit.params
if self.transparams:
params = self._transparams(params)
self.transparams = False # turn off now for other results
pinv_exog = np.linalg.pinv(X)
normalized_cov_params = np.dot(pinv_exog, pinv_exog.T)
arfit = ARResults(copy.copy(self), params, normalized_cov_params)
if method == 'mle' and full_output:
arfit.mle_retvals = mlefit.mle_retvals
arfit.mle_settings = mlefit.mle_settings
# Set fit params since completed the fit
if self._fit_params is None:
self._fit_params = fit_params
return ARResultsWrapper(arfit)
[docs]class ARResults(tsa_model.TimeSeriesModelResults):
"""
Class to hold results from fitting an AR model.
Parameters
----------
model : AR Model instance
Reference to the model that is fit.
params : ndarray
The fitted parameters from the AR Model.
normalized_cov_params : ndarray
The array inv(dot(x.T,x)) where x contains the regressors in the
model.
scale : float, optional
An estimate of the scale of the model.
Attributes
----------
k_ar : float
Lag length. Sometimes used as `p` in the docs.
k_trend : float
The number of trend terms included. 'nc'=0, 'c'=1.
llf : float
The loglikelihood of the model evaluated at `params`. See `AR.loglike`
model : AR model instance
A reference to the fitted AR model.
nobs : float
The number of available observations `nobs` - `k_ar`
n_totobs : float
The number of total observations in `endog`. Sometimes `n` in the docs.
params : ndarray
The fitted parameters of the model.
scale : float
Same as sigma2
sigma2 : float
The variance of the innovations (residuals).
trendorder : int
The polynomial order of the trend. 'nc' = None, 'c' or 't' = 0,
'ct' = 1, etc.
"""
_cache = {} # for scale setter
def __init__(self, model, params, normalized_cov_params=None, scale=1.):
super(ARResults, self).__init__(model, params, normalized_cov_params,
scale)
self._cache = {}
self.nobs = model.nobs
n_totobs = len(model.endog)
self.n_totobs = n_totobs
self.X = model.X # copy?
self.Y = model.Y
k_ar = model.k_ar
self.k_ar = k_ar
k_trend = model.k_trend
self.k_trend = k_trend
trendorder = None
if k_trend > 0:
trendorder = k_trend - 1
self.trendorder = trendorder
# TODO: cmle vs mle?
self.df_model = k_ar + k_trend
self.df_resid = self.model.df_resid = n_totobs - self.df_model
[docs] @cache_writable()
def sigma2(self):
model = self.model
if model.method == "cmle": # do DOF correction
return 1. / self.nobs * sumofsq(self.resid)
else:
return self.model.sigma2
[docs] @cache_writable() # for compatability with RegressionResults
def scale(self):
return self.sigma2
@cache_readonly
def bse(self): # allow user to specify?
"""
The standard errors of the estimated parameters.
If `method` is 'cmle', then the standard errors that are returned are
the OLS standard errors of the coefficients. If the `method` is 'mle'
then they are computed using the numerical Hessian.
"""
if self.model.method == "cmle": # uses different scale/sigma def.
resid = self.resid
ssr = np.dot(resid, resid)
ols_scale = ssr / (self.nobs - self.k_ar - self.k_trend)
return np.sqrt(np.diag(self.cov_params(scale=ols_scale)))
else:
hess = approx_hess(self.params, self.model.loglike)
return np.sqrt(np.diag(-np.linalg.inv(hess)))
@cache_readonly
def pvalues(self):
"""The p values associated with the standard errors."""
return norm.sf(np.abs(self.tvalues)) * 2
@cache_readonly
def aic(self):
"""
Akaike Information Criterion using Lutkephol's definition.
:math:`log(sigma) + 2*(1 + k_ar + k_trend)/nobs`
"""
# TODO: this is based on loglike with dropped constant terms ?
# Lutkepohl
# return np.log(self.sigma2) + 1./self.model.nobs * self.k_ar
# Include constant as estimated free parameter and double the loss
return np.log(self.sigma2) + 2 * (1 + self.df_model) / self.nobs
# Stata defintion
# nobs = self.nobs
# return -2 * self.llf/nobs + 2 * (self.k_ar+self.k_trend)/nobs
@cache_readonly
def hqic(self):
"""Hannan-Quinn Information Criterion."""
nobs = self.nobs
# Lutkepohl
# return np.log(self.sigma2)+ 2 * np.log(np.log(nobs))/nobs * self.k_ar
# R uses all estimated parameters rather than just lags
return (np.log(self.sigma2) + 2 * np.log(np.log(nobs))
/ nobs * (1 + self.df_model))
# Stata
# nobs = self.nobs
# return -2 * self.llf/nobs + 2 * np.log(np.log(nobs))/nobs * \
# (self.k_ar + self.k_trend)
@cache_readonly
def fpe(self):
"""
Final prediction error using Lütkepohl's definition.
((n_totobs+k_trend)/(n_totobs-k_ar-k_trend))*sigma
"""
nobs = self.nobs
df_model = self.df_model
# Lutkepohl
return ((nobs + df_model) / (nobs - df_model)) * self.sigma2
@cache_readonly
def bic(self):
"""
Bayes Information Criterion
:math:`\\log(\\sigma) + (1 + k_ar + k_trend)*\\log(nobs)/nobs`
"""
nobs = self.nobs
# Lutkepohl
# return np.log(self.sigma2) + np.log(nobs)/nobs * self.k_ar
# Include constant as est. free parameter
return np.log(self.sigma2) + (1 + self.df_model) * np.log(nobs) / nobs
# Stata
# return -2 * self.llf/nobs + np.log(nobs)/nobs * (self.k_ar + \
# self.k_trend)
@cache_readonly
def resid(self):
"""
The residuals of the model.
If the model is fit by 'mle' then the pre-sample residuals are
calculated using fittedvalues from the Kalman Filter.
"""
# NOTE: uses fittedvalues because it calculate presample values for mle
model = self.model
endog = model.endog.squeeze()
if model.method == "cmle": # elimate pre-sample
return endog[self.k_ar:] - self.fittedvalues
else:
return model.endog.squeeze() - self.fittedvalues
@cache_readonly
def roots(self):
"""
The roots of the AR process.
The roots are the solution to
(1 - arparams[0]*z - arparams[1]*z**2 -...- arparams[p-1]*z**k_ar) = 0.
Stability requires that the roots in modulus lie outside the unit
circle.
"""
k = self.k_trend
return np.roots(np.r_[1, -self.params[k:]]) ** -1
@cache_readonly
def arfreq(self):
r"""
Returns the frequency of the AR roots.
This is the solution, x, to z = abs(z)*exp(2j*np.pi*x) where z are the
roots.
"""
z = self.roots
return np.arctan2(z.imag, z.real) / (2 * np.pi)
@cache_readonly
def fittedvalues(self):
"""
The in-sample predicted values of the fitted AR model.
The `k_ar` initial values are computed via the Kalman Filter if the
model is fit by `mle`.
"""
return self.model.predict(self.params)
[docs] @Appender(remove_parameters(AR.predict.__doc__, 'params'))
def predict(self, start=None, end=None, dynamic=False):
params = self.params
predictedvalues = self.model.predict(params, start, end, dynamic)
return predictedvalues
# TODO: consider returning forecast errors and confidence intervals?
[docs] def summary(self, alpha=.05):
"""Summarize the Model
Parameters
----------
alpha : float, optional
Significance level for the confidence intervals.
Returns
-------
smry : Summary instance
This holds the summary table and text, which can be printed or
converted to various output formats.
See Also
--------
statsmodels.iolib.summary.Summary
"""
model = self.model
title = model.__class__.__name__ + ' Model Results'
method = model.method
# get sample
start = 0 if 'mle' in method else self.k_ar
if self.data.dates is not None:
dates = self.data.dates
sample = [dates[start].strftime('%m-%d-%Y')]
sample += ['- ' + dates[-1].strftime('%m-%d-%Y')]
else:
sample = str(start) + ' - ' + str(len(self.data.orig_endog))
k_ar = self.k_ar
order = '({0})'.format(k_ar)
dep_name = str(self.model.endog_names)
top_left = [('Dep. Variable:', dep_name),
('Model:', [model.__class__.__name__ + order]),
('Method:', [method]),
('Date:', None),
('Time:', None),
('Sample:', [sample[0]]),
('', [sample[1]])
]
top_right = [
('No. Observations:', [str(len(self.model.endog))]),
('Log Likelihood', ["%#5.3f" % self.llf]),
('S.D. of innovations', ["%#5.3f" % self.sigma2 ** .5]),
('AIC', ["%#5.3f" % self.aic]),
('BIC', ["%#5.3f" % self.bic]),
('HQIC', ["%#5.3f" % self.hqic])]
smry = Summary()
smry.add_table_2cols(self, gleft=top_left, gright=top_right,
title=title)
smry.add_table_params(self, alpha=alpha, use_t=False)
# Make the roots table
from statsmodels.iolib.table import SimpleTable
if k_ar:
arstubs = ["AR.%d" % i for i in range(1, k_ar + 1)]
stubs = arstubs
roots = self.roots
freq = self.arfreq
else: # AR(0) model
stubs = []
if len(stubs): # not AR(0)
modulus = np.abs(roots)
data = np.column_stack((roots.real, roots.imag, modulus, freq))
roots_table = SimpleTable([('%17.4f' % row[0],
'%+17.4fj' % row[1],
'%17.4f' % row[2],
'%17.4f' % row[3]) for row in data],
headers=[' Real',
' Imaginary',
' Modulus',
' Frequency'],
title="Roots",
stubs=stubs)
smry.tables.append(roots_table)
return smry
class ARResultsWrapper(wrap.ResultsWrapper):
_attrs = {}
_wrap_attrs = wrap.union_dicts(
tsa_model.TimeSeriesResultsWrapper._wrap_attrs, _attrs)
_methods = {}
_wrap_methods = wrap.union_dicts(
tsa_model.TimeSeriesResultsWrapper._wrap_methods, _methods)
wrap.populate_wrapper(ARResultsWrapper, ARResults)
doc = Docstring(AutoReg.predict.__doc__)
_predict_params = doc.extract_parameters(['start', 'end', 'dynamic',
'exog', 'exog_oos'], 8)
[docs]class AutoRegResults(tsa_model.TimeSeriesModelResults):
"""
Class to hold results from fitting an AutoReg model.
Parameters
----------
model : AutoReg
Reference to the model that is fit.
params : ndarray
The fitted parameters from the AR Model.
cov_params : ndarray
The estimated covariance matrix of the model parameters.
normalized_cov_params : ndarray
The array inv(dot(x.T,x)) where x contains the regressors in the
model.
scale : float, optional
An estimate of the scale of the model.
"""
_cache = {} # for scale setter
def __init__(self, model, params, cov_params, normalized_cov_params=None,
scale=1.):
super(AutoRegResults, self).__init__(model, params,
normalized_cov_params, scale)
self._cache = {}
self._params = params
self._nobs = model.nobs
self._n_totobs = model.endog.shape[0]
self._df_model = model.df_model
self._ar_lags = model.ar_lags
self._max_lag = 0
if self._ar_lags.shape[0] > 0:
self._max_lag = self._ar_lags.max()
self._hold_back = self.model.hold_back
self.cov_params_default = cov_params
[docs] def initialize(self, model, params, **kwargs):
"""
Initialize (possibly re-initialize) a Results instance.
Parameters
----------
model : Model
The model instance.
params : ndarray
The model parameters.
**kwargs
Any additional keyword arguments required to initialize the model.
"""
self._params = params
self.model = model
@property
def ar_lags(self):
"""The autoregressive lags included in the model"""
return self._ar_lags
@property
def params(self):
"""The estimated parameters."""
return self._params
@property
def df_model(self):
"""The degrees of freedom consumed by the model."""
return self._df_model
@property
def df_resid(self):
"""The remaining degrees of freedom in the residuals."""
return self.nobs - self._df_model
@property
def nobs(self):
"""
The number of observations after adjusting for losses due to lags.
"""
return self._nobs
[docs] @cache_writable()
def sigma2(self):
return 1. / self.nobs * sumofsq(self.resid)
[docs] @cache_writable() # for compatability with RegressionResults
def scale(self):
return self.sigma2
@cache_readonly
def bse(self): # allow user to specify?
"""
The standard errors of the estimated parameters.
If `method` is 'cmle', then the standard errors that are returned are
the OLS standard errors of the coefficients. If the `method` is 'mle'
then they are computed using the numerical Hessian.
"""
return np.sqrt(np.diag(self.cov_params()))
@cache_readonly
def aic(self):
"""
Akaike Information Criterion using Lutkephol's definition.
:math:`log(sigma) + 2*(1 + df_model) / nobs`
"""
# This is based on loglike with dropped constant terms ?
# Lutkepohl
# return np.log(self.sigma2) + 1./self.model.nobs * self.k_ar
# Include constant as estimated free parameter and double the loss
# Stata defintion
# nobs = self.nobs
# return -2 * self.llf/nobs + 2 * (self.k_ar+self.k_trend)/nobs
return np.log(self.sigma2) + 2 * (1 + self.df_model) / self.nobs
@cache_readonly
def hqic(self):
"""Hannan-Quinn Information Criterion."""
# Lutkepohl
# return np.log(self.sigma2)+ 2 * np.log(np.log(nobs))/nobs * self.k_ar
# R uses all estimated parameters rather than just lags
# Stata
# nobs = self.nobs
# return -2 * self.llf/nobs + 2 * np.log(np.log(nobs))/nobs * \
# (self.k_ar + self.k_trend)
nobs = self.nobs
loglog_n = np.log(np.log(nobs))
log_sigma2 = np.log(self.sigma2)
return (log_sigma2 + 2 * loglog_n / nobs * (1 + self.df_model))
@cache_readonly
def fpe(self):
"""
Final prediction error using Lütkepohl's definition.
((n_totobs+k_trend)/(n_totobs-k_ar-k_trend))*sigma
"""
nobs = self.nobs
df_model = self.df_model
# Lutkepohl
return ((nobs + df_model) / (nobs - df_model)) * self.sigma2
@cache_readonly
def bic(self):
r"""
Bayes Information Criterion
:math:`\ln(\sigma) + df_{model} \ln(nobs)/nobs`
"""
# Lutkepohl
# np.log(self.sigma2) + np.log(nobs)/nobs * self.k_ar
# Include constant as est. free parameter
# Stata
# -2 * self.llf/nobs + np.log(nobs)/nobs * (self.k_ar + self.k_trend)
nobs = self.nobs
return np.log(self.sigma2) + (1 + self.df_model) * np.log(nobs) / nobs
@cache_readonly
def resid(self):
"""
The residuals of the model.
"""
model = self.model
endog = model.endog.squeeze()
return endog[self._hold_back:] - self.fittedvalues
def _lag_repr(self):
"""Returns poly repr of an AR, (1 -phi1 L -phi2 L^2-...)"""
k_ar = len(self.ar_lags)
ar_params = np.zeros(self._max_lag + 1)
ar_params[0] = 1
df_model = self._df_model
exog = self.model.exog
k_exog = exog.shape[1] if exog is not None else 0
params = self._params[df_model - k_ar - k_exog:df_model - k_exog]
for i, lag in enumerate(self._ar_lags):
ar_params[lag] = -params[i]
return ar_params
@cache_readonly
def roots(self):
"""
The roots of the AR process.
The roots are the solution to
(1 - arparams[0]*z - arparams[1]*z**2 -...- arparams[p-1]*z**k_ar) = 0.
Stability requires that the roots in modulus lie outside the unit
circle.
"""
lag_repr = self._lag_repr()
if lag_repr.shape[0] == 1:
return np.empty(0)
return np.roots(lag_repr) ** -1
@cache_readonly
def arfreq(self):
r"""
Returns the frequency of the AR roots.
This is the solution, x, to z = abs(z)*exp(2j*np.pi*x) where z are the
roots.
"""
z = self.roots
return np.arctan2(z.imag, z.real) / (2 * np.pi)
@cache_readonly
def fittedvalues(self):
"""
The in-sample predicted values of the fitted AR model.
The `k_ar` initial values are computed via the Kalman Filter if the
model is fit by `mle`.
"""
return self.model.predict(self.params)
[docs] def test_serial_correlation(self, lags=None, model_df=None):
"""
Ljung-Box test for residual serial correlation
Parameters
----------
lags : int
The maximum number of lags to use in the test. Jointly tests that
all autocorrelations up to and including lag j are zero for
j = 1, 2, ..., lags. If None, uses lag=12*(nobs/100)^{1/4}.
model_df : int
The model degree of freedom to use when adjusting computing the
test statistic to account for parameter estimation. If None, uses
the number of AR lags included in the model.
Returns
-------
output : DataFrame
DataFrame containing three columns: the test statistic, the
p-value of the test, and the degree of freedom used in the test.
Notes
-----
Null hypothesis is no serial correlation.
The the test degree-of-freedom is 0 or negative once accounting for
model_df, then the test statistic's p-value is missing.
See Also
--------
statsmodels.stats.diagnostic.acorr_ljungbox
Ljung-Box test for serial correlation.
"""
# Deferred to prevent circular import
from statsmodels.stats.diagnostic import acorr_ljungbox
lags = int_like(lags, 'lags', optional=True)
model_df = int_like(model_df, 'df_model', optional=True)
model_df = len(self.ar_lags) if model_df is None else model_df
nobs_effective = self.resid.shape[0]
# Default lags for acorr_ljungbox is 40, but may not always have
# that many observations
if lags is None:
lags = int(min(12 * (nobs_effective / 100) ** (1 / 4),
nobs_effective - 1))
test_stats = acorr_ljungbox(self.resid, lags=lags, boxpierce=False,
model_df=model_df, return_df=False)
cols = ['Ljung-Box', 'LB P-value', 'DF']
if lags == 1:
test_stats = [list(test_stats) + [max(0, 1 - model_df)]]
else:
df = np.clip(np.arange(1, lags + 1) - model_df, 0, np.inf).astype(
np.int)
test_stats = list(test_stats) + [df]
test_stats = [[test_stats[i][j] for i in range(3)] for j in
range(lags)]
index = pd.RangeIndex(1, lags + 1, name='Lag')
return pd.DataFrame(test_stats,
columns=cols,
index=index)
[docs] def test_normality(self):
"""
Test for normality of standardized residuals.
Returns
-------
Series
Series containing four values, the test statistic and its p-value,
the skewness and the kurtosis.
Notes
-----
Null hypothesis is normality.
See Also
--------
statsmodels.stats.stattools.jarque_bera
The Jarque-Bera test of normality.
"""
# Deferred to prevent circular import
from statsmodels.stats.stattools import jarque_bera
index = ['Jarque-Bera', 'P-value', 'Skewness', 'Kurtosis']
return pd.Series(jarque_bera(self.resid), index=index)
[docs] def test_heteroskedasticity(self, lags=None):
"""
ARCH-LM test of residual heteroskedasticity
Parameters
----------
lags : int
The maximum number of lags to use in the test. Jointly tests that
all squared autocorrelations up to and including lag j are zero for
j = 1, 2, ..., lags. If None, uses lag=12*(nobs/100)^{1/4}.
Returns
-------
Series
Series containing the test statistic and its p-values.
See Also
--------
statsmodels.stats.diagnostic.het_arch
ARCH-LM test.
statsmodels.stats.diagnostic.acorr_lm
LM test for autocorrelation.
"""
from statsmodels.stats.diagnostic import het_arch
lags = int_like(lags, 'lags', optional=True)
nobs_effective = self.resid.shape[0]
if lags is None:
max_lag = (nobs_effective - 1) // 2
lags = int(min(12 * (nobs_effective / 100) ** (1 / 4), max_lag))
out = []
for lag in range(1, lags + 1):
res = het_arch(self.resid, maxlag=lag, autolag=None)
out.append([res[0], res[1], lag])
index = pd.RangeIndex(1, lags + 1, name='Lag')
cols = ['ARCH-LM', 'P-value', 'DF']
return pd.DataFrame(out, columns=cols, index=index)
[docs] def diagnostic_summary(self):
"""
Returns a summary containing standard model diagnostic tests
Returns
-------
Summary
A summary instance with panels for serial correlation tests,
normality tests and heteroskedasticity tests.
See Also
--------
test_serial_correlation
Test models residuals for serial correlation.
test_normality
Test models residuals for deviations from normality.
test_heteroskedasticity
Test models residuals for conditional heteroskedasticity.
"""
from statsmodels.iolib.table import SimpleTable
spacer = SimpleTable([''])
smry = Summary()
sc = self.test_serial_correlation()
sc = sc.loc[sc.DF > 0]
values = [[i + 1] + row for i, row in enumerate(sc.values.tolist())]
data_fmts = ('%10d', '%10.3f', '%10.3f', '%10d')
if sc.shape[0]:
tab = SimpleTable(values,
headers=['Lag'] + list(sc.columns),
title='Test of No Serial Correlation',
header_align='r', data_fmts=data_fmts)
smry.tables.append(tab)
smry.tables.append(spacer)
jb = self.test_normality()
data_fmts = ('%10.3f', '%10.3f', '%10.3f', '%10.3f')
tab = SimpleTable([jb.values], headers=list(jb.index),
title='Test of Normality',
header_align='r', data_fmts=data_fmts)
smry.tables.append(tab)
smry.tables.append(spacer)
arch_lm = self.test_heteroskedasticity()
values = [[i + 1] + row for i, row in
enumerate(arch_lm.values.tolist())]
data_fmts = ('%10d', '%10.3f', '%10.3f', '%10d')
tab = SimpleTable(values,
headers=['Lag'] + list(arch_lm.columns),
title='Test of Conditional Homoskedasticity',
header_align='r', data_fmts=data_fmts)
smry.tables.append(tab)
return smry
[docs] @Appender(remove_parameters(AutoReg.predict.__doc__, 'params'))
def predict(self, start=None, end=None, dynamic=False, exog=None,
exog_oos=None):
return self.model.predict(self._params, start=start, end=end,
dynamic=dynamic, exog=exog,
exog_oos=exog_oos)
[docs] @Substitution(predict_params=_predict_params)
def plot_predict(self, start=None, end=None, dynamic=False, exog=None,
exog_oos=None, alpha=.05, in_sample=True, fig=None,
figsize=None):
"""
Plot in- and out-of-sample predictions
Parameters
----------
%(predict_params)s
alpha : {float, None}
The tail probability not covered by the confidence interval. Must
be in (0, 1). Confidence interval is constructed assuming normally
distributed shocks. If None, figure will not show the confidence
interval.
in_sample : bool
Flag indicating whether to include the in-sample period in the
plot.
fig : Figure
An existing figure handle. If not provided, a new figure is
created.
figsize: tuple[float, float]
Tuple containing the figure size values.
Returns
-------
Figure
Figure handle containing the plot.
"""
from statsmodels.graphics.utils import _import_mpl, create_mpl_fig
_import_mpl()
fig = create_mpl_fig(fig, figsize)
predictions = self.predict(start=start, end=end, dynamic=dynamic,
exog=exog, exog_oos=exog_oos)
start = 0 if start is None else start
end = self.model._index[-1] if end is None else end
_, _, oos, _ = self.model._get_prediction_index(start, end)
ax = fig.add_subplot(111)
if in_sample:
ax.plot(predictions)
elif oos:
if isinstance(predictions, pd.Series):
predictions = predictions.iloc[-oos:]
else:
predictions = predictions[-oos:]
else:
raise ValueError('in_sample is False but there are no'
'out-of-sample forecasts to plot.')
if oos and alpha is not None:
pred_oos = np.asarray(predictions)[-oos:]
ar_params = self._lag_repr()
ma = arma2ma(ar_params, [1], lags=oos)
fc_error = np.sqrt(self.sigma2) * np.cumsum(ma ** 2)
quantile = norm.ppf(alpha / 2)
lower = pred_oos + fc_error * quantile
upper = pred_oos + fc_error * -quantile
label = "{0:.0%} confidence interval".format(1 - alpha)
x = ax.get_lines()[-1].get_xdata()
ax.fill_between(x[-oos:], lower, upper,
color='gray', alpha=.5, label=label)
ax.legend(loc='best')
return fig
[docs] def plot_diagnostics(self, lags=10, fig=None, figsize=None):
"""
Diagnostic plots for standardized residuals
Parameters
----------
lags : int, optional
Number of lags to include in the correlogram. Default is 10.
fig : Figure, optional
If given, subplots are created in this figure instead of in a new
figure. Note that the 2x2 grid will be created in the provided
figure using `fig.add_subplot()`.
figsize : tuple, optional
If a figure is created, this argument allows specifying a size.
The tuple is (width, height).
Notes
-----
Produces a 2x2 plot grid with the following plots (ordered clockwise
from top left):
1. Standardized residuals over time
2. Histogram plus estimated density of standardized residuals, along
with a Normal(0,1) density plotted for reference.
3. Normal Q-Q plot, with Normal reference line.
4. Correlogram
See Also
--------
statsmodels.graphics.gofplots.qqplot
statsmodels.graphics.tsaplots.plot_acf
"""
from statsmodels.graphics.utils import _import_mpl, create_mpl_fig
_import_mpl()
fig = create_mpl_fig(fig, figsize)
# Eliminate residuals associated with burned or diffuse likelihoods
resid = self.resid
# Top-left: residuals vs time
ax = fig.add_subplot(221)
if hasattr(self.model.data, 'dates') and self.data.dates is not None:
x = self.model.data.dates._mpl_repr()
x = x[self.model.hold_back:]
else:
hold_back = self.model.hold_back
x = hold_back + np.arange(self.resid.shape[0])
std_resid = resid / np.sqrt(self.sigma2)
ax.plot(x, std_resid)
ax.hlines(0, x[0], x[-1], alpha=0.5)
ax.set_xlim(x[0], x[-1])
ax.set_title('Standardized residual')
# Top-right: histogram, Gaussian kernel density, Normal density
# Can only do histogram and Gaussian kernel density on the non-null
# elements
std_resid_nonmissing = std_resid[~(np.isnan(resid))]
ax = fig.add_subplot(222)
# gh5792: Remove except after support for matplotlib>2.1 required
try:
ax.hist(std_resid_nonmissing, density=True, label='Hist')
except AttributeError:
ax.hist(std_resid_nonmissing, normed=True, label='Hist')
kde = gaussian_kde(std_resid)
xlim = (-1.96 * 2, 1.96 * 2)
x = np.linspace(xlim[0], xlim[1])
ax.plot(x, kde(x), label='KDE')
ax.plot(x, norm.pdf(x), label='N(0,1)')
ax.set_xlim(xlim)
ax.legend()
ax.set_title('Histogram plus estimated density')
# Bottom-left: QQ plot
ax = fig.add_subplot(223)
from statsmodels.graphics.gofplots import qqplot
qqplot(std_resid, line='s', ax=ax)
ax.set_title('Normal Q-Q')
# Bottom-right: Correlogram
ax = fig.add_subplot(224)
from statsmodels.graphics.tsaplots import plot_acf
plot_acf(resid, ax=ax, lags=lags)
ax.set_title('Correlogram')
ax.set_ylim(-1, 1)
return fig
[docs] def summary(self, alpha=.05):
"""
Summarize the Model
Parameters
----------
alpha : float, optional
Significance level for the confidence intervals.
Returns
-------
smry : Summary instance
This holds the summary table and text, which can be printed or
converted to various output formats.
See Also
--------
statsmodels.iolib.summary.Summary
"""
model = self.model
title = model.__class__.__name__ + ' Model Results'
method = 'Conditional MLE'
# get sample
start = self._hold_back
if self.data.dates is not None:
dates = self.data.dates
sample = [dates[start].strftime('%m-%d-%Y')]
sample += ['- ' + dates[-1].strftime('%m-%d-%Y')]
else:
sample = [str(start), str(len(self.data.orig_endog))]
model = model.__class__.__name__
if self.model.seasonal:
model = 'Seas. ' + model
if len(self.ar_lags) < self._max_lag:
model = 'Restr. ' + model
if self.model.exog is not None:
model += '-X'
order = '({0})'.format(self._max_lag)
dep_name = str(self.model.endog_names)
top_left = [('Dep. Variable:', [dep_name]),
('Model:', [model + order]),
('Method:', [method]),
('Date:', None),
('Time:', None),
('Sample:', [sample[0]]),
('', [sample[1]])
]
top_right = [
('No. Observations:', [str(len(self.model.endog))]),
('Log Likelihood', ["%#5.3f" % self.llf]),
('S.D. of innovations', ["%#5.3f" % self.sigma2 ** .5]),
('AIC', ["%#5.3f" % self.aic]),
('BIC', ["%#5.3f" % self.bic]),
('HQIC', ["%#5.3f" % self.hqic])]
smry = Summary()
smry.add_table_2cols(self, gleft=top_left, gright=top_right,
title=title)
smry.add_table_params(self, alpha=alpha, use_t=False)
# Make the roots table
from statsmodels.iolib.table import SimpleTable
if self._max_lag:
arstubs = ["AR.%d" % i for i in range(1, self._max_lag + 1)]
stubs = arstubs
roots = self.roots
freq = self.arfreq
modulus = np.abs(roots)
data = np.column_stack((roots.real, roots.imag, modulus, freq))
roots_table = SimpleTable([('%17.4f' % row[0],
'%+17.4fj' % row[1],
'%17.4f' % row[2],
'%17.4f' % row[3]) for row in data],
headers=[' Real',
' Imaginary',
' Modulus',
' Frequency'],
title="Roots",
stubs=stubs)
smry.tables.append(roots_table)
return smry
class AutoRegResultsWrapper(wrap.ResultsWrapper):
_attrs = {}
_wrap_attrs = wrap.union_dicts(
tsa_model.TimeSeriesResultsWrapper._wrap_attrs, _attrs)
_methods = {}
_wrap_methods = wrap.union_dicts(
tsa_model.TimeSeriesResultsWrapper._wrap_methods, _methods)
wrap.populate_wrapper(AutoRegResultsWrapper, AutoRegResults)
doc = Docstring(AutoReg.__doc__)
_auto_reg_params = doc.extract_parameters(['trend', 'seasonal', 'exog',
'hold_back', 'period', 'missing'],
4)
[docs]@Substitution(auto_reg_params=_auto_reg_params)
def ar_select_order(endog, maxlag, ic='bic', glob=False, trend='c',
seasonal=False, exog=None, hold_back=None, period=None,
missing='none'):
"""
Autoregressive AR-X(p) model order selection.
Parameters
----------
endog : array_like
A 1-d endogenous response variable. The independent variable.
maxlag : int
The maximum lag to consider.
ic : {'aic', 'hqic', 'bic'}
The information criterion to use in the selection.
glob : bool
Flag indicating where to use a global search across all combinations
of lags. In practice, this option is not computational feasible when
maxlag is larger than 15 (or perhaps 20) since the global search
requires fitting 2**maxlag models.
%(auto_reg_params)s
Returns
-------
AROrderSelectionResults
A results holder containing the model and the complete set of
information criteria for all models fit.
Examples
--------
>>> from statsmodels.tsa.ar_model import ar_select_order
>>> data = sm.datasets.sunspots.load_pandas().data['SUNACTIVITY']
Determine the optimal lag structure
>>> mod = ar_select_order(data, maxlag=13)
>>> mod.ar_lags
array([1, 2, 3, 4, 5, 6, 7, 8, 9])
Determine the optimal lag structure with seasonal terms
>>> mod = ar_select_order(data, maxlag=13, seasonal=True, period=12)
>>> mod.ar_lags
array([1, 2, 3, 4, 5, 6, 7, 8, 9])
Globally determine the optimal lag structure
>>> mod = ar_select_order(data, maxlag=13, glob=True)
>>> mod.ar_lags
array([1, 2, 9])
"""
full_mod = AutoReg(endog, maxlag, trend=trend, seasonal=seasonal,
exog=exog, hold_back=hold_back, period=period,
missing=missing)
nexog = full_mod.exog.shape[1] if full_mod.exog is not None else 0
y, x = full_mod._y, full_mod._x
base_col = x.shape[1] - nexog - maxlag
sel = np.ones(x.shape[1], dtype=bool)
ics = []
def compute_ics(res):
nobs = res.nobs
df_model = res.df_model
sigma2 = 1. / nobs * sumofsq(res.resid)
res = SimpleNamespace(nobs=nobs, df_model=df_model, sigma2=sigma2)
aic = AutoRegResults.aic.func(res)
bic = AutoRegResults.bic.func(res)
hqic = AutoRegResults.hqic.func(res)
return aic, bic, hqic
def ic_no_data():
"""Fake mod and results to handle no regressor case"""
mod = SimpleNamespace(nobs=y.shape[0],
endog=y,
exog=np.empty((y.shape[0], 0)))
llf = OLS.loglike(mod, np.empty(0))
res = SimpleNamespace(resid=y, nobs=y.shape[0], llf=llf,
df_model=0, k_constant=0)
return compute_ics(res)
if not glob:
sel[base_col: base_col + maxlag] = False
for i in range(maxlag + 1):
sel[base_col:base_col + i] = True
if not np.any(sel):
ics.append((0, ic_no_data()))
continue
res = OLS(y, x[:, sel]).fit()
lags = tuple(j for j in range(1, i + 1))
lags = 0 if not lags else lags
ics.append((lags, compute_ics(res)))
else:
bits = np.arange(2 ** maxlag, dtype=np.int32)[:, None]
bits = bits.view(np.uint8)
bits = np.unpackbits(bits).reshape(-1, 32)
for i in range(4):
bits[:, 8 * i:8 * (i + 1)] = bits[:, 8 * i:8 * (i + 1)][:, ::-1]
masks = bits[:, :maxlag]
for mask in masks:
sel[base_col:base_col + maxlag] = mask
if not np.any(sel):
ics.append((0, ic_no_data()))
continue
res = OLS(y, x[:, sel]).fit()
lags = tuple(np.where(mask)[0] + 1)
lags = 0 if not lags else lags
ics.append((lags, compute_ics(res)))
key_loc = {'aic': 0, 'bic': 1, 'hqic': 2}[ic]
ics = sorted(ics, key=lambda x: x[1][key_loc])
selected_model = ics[0][0]
mod = AutoReg(endog, selected_model, trend=trend, seasonal=seasonal,
exog=exog, hold_back=hold_back, period=period,
missing=missing)
return AROrderSelectionResults(mod, ics, trend, seasonal, period)
class AROrderSelectionResults(object):
"""
Results from an AR order selection
Contains the information criteria for all fitted model orders.
"""
def __init__(self, model, ics, trend, seasonal, period):
self._model = model
self._ics = ics
self._trend = trend
self._seasonal = seasonal
self._period = period
aic = sorted(ics, key=lambda r: r[1][0])
self._aic = dict([(key, val[0]) for key, val in aic])
bic = sorted(ics, key=lambda r: r[1][1])
self._bic = dict([(key, val[1]) for key, val in bic])
hqic = sorted(ics, key=lambda r: r[1][2])
self._hqic = dict([(key, val[2]) for key, val in hqic])
@property
def model(self):
"""The model selected using the chosen information criterion."""
return self._model
@property
def seasonal(self):
"""Flag indicating if a seasonal component is included."""
return self._seasonal
@property
def trend(self):
"""The trend included in the model selection."""
return self._trend
@property
def period(self):
"""The period of the seasonal component."""
return self._period
@property
def aic(self):
"""
The Akaike information criterion for the models fit.
Returns
-------
dict[tuple, float]
"""
return self._aic
@property
def bic(self):
"""
The Bayesian (Schwarz) information criteria for the models fit.
Returns
-------
dict[tuple, float]
"""
return self._bic
@property
def hqic(self):
"""
The Hannan-Quinn information criteria for the models fit.
Returns
-------
dict[tuple, float]
"""
return self._hqic
@property
def ar_lags(self):
"""The lags included in the selected model."""
return self._model.ar_lags